Qalakturon turşusu

Vikipediya, açıq ensiklopediya
Keçid et: naviqasiya, axtar
Qalakturon turşusu
Qalakturon turşusu:kimyəvi formul
Ümumi
Kimyəvi formulu C6H10O7
Molyar kütlə 194,1 q/mol
Təsnifatı
CAS -da qeyd. nöm. 685-73-4
SMILES C(=O)[C@@H]([C@H]([C@H]([C@@H](C(=O)O)O)O)O)O

Qalakturon turşusu, heksuron turşusu, C6H10O7- birәsaslı üzvi turşu.

Qalaktozanın 6-cı karbon atomu oksidlәşәndә әmәlә gәlir. Qalakturon turşusu polisaxaridlәrdәn bir çoxunun quruluş komponenti olub tәbiәtdә geniş yayılmışdır. Bitkilərin toxumalarında asanlıqla әmәlә gәlir, kitrә, selik vә s.-nin tәrkibindә var. Bitkilәrdә dekarboksilaza fermentinin tәsiri ilә arabinozaya çevrilir.