Qlükoza üçün mənbəyə bax

{{Maddə
| verifiedrevid = 818842877
| Name = <small>D</small>-Glucose
| pronounce = {{IPAc-en|ˈ|ɡ|l|uː|k|oʊ|z}}, {{IPAc-en|ˈ|ɡ|l|uː|k|oʊ|s}}
| ImageFile1=Alpha-D-glucopyranose-2D-skeletal.png
| ImageCaption1 = α-<small>D</small>-glucopyranose ([[Cyclohexane conformation|chair form]])
| ImageFile2 = Alpha-D-Glucopyranose.svg
| ImageSize2 = 120
| ImageCaption2 = [[Haworth projection]] of α-<small>D</small>-glucopyranose
| ImageFile3 = D-glucose-chain-2D-Fischer.png
| ImageSize3 = 100
| ImageCaption3 = [[Fischer projection]] of <small>D</small>-glucose
| PIN = <small>D</small>-Glucose
| SystematicName = (2''R'',3''S'',4''R'',5''R'')-2,3,4,5,6-Pentahydroxyhexanal
| OtherNames = Blood sugar<br />Dextrose<br />Corn sugar<br /><small>D</small>-Glucose<br />Grape sugar
|Section1={{Chembox Identifiers
| IUPHAR_ligand = 4536
| Abbreviations = Glc
| CASNo_Ref = {{cascite|changed|CAS}}
| PubChem = 5793
| ChemSpiderID = 5589
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| UNII = 5SL0G7R0OK
| UNII_Ref = {{fdacite|correct|FDA}}
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 1222250
| EINECS = 200-075-1
| MeSHName = Glucose
| ChEBI_Ref = {{ebicite|correct|EBI}}
| ChEBI = 4167
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = C00031
| RTECS = LZ6600000
| SMILES = OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O
| SMILES1 = C([C@@H]1[C@H]([C@@H]([C@H]([C@H](O1)O)O)O)O)O
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C6H12O6/c7-1-2-3(8)4(9)5(10)6(11)12-2/h2-11H,1H2/t2-,3-,4+,5-,6?/m1/s1
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = WQZGKKKJIJFFOK-GASJEMHNSA-N
| Beilstein = 1281604
| Gmelin = 83256
| 3DMet = B01203
}}
|Section2={{Chembox Properties
| C=6 | H=12 | O=6
| Appearance = White powder
| MeltingPt = α-<small>D</small>-glucose:
| MeltingPtC = 146
| MeltingPt_notes = <br />β-<small>D</small>-glucose: 150°C (302°F; 423 K)
| Density = 1.54&nbsp;g/cm<sup>3</sup>
| Solubility = 909&nbsp;g/L ({{convert|25|C}})
| Dipole = 8.6827
| MagSus = −101.5×10<sup>−6</sup> cm<sup>3</sup>/mol
  }}
|Section5={{Chembox Thermochemistry
| DeltaHf = −1271&nbsp;kJ/mol <ref>{{citation | last1 = Ponomarev | first1 = V. V. | last2 = Migarskaya | first2 = L. B. | title = Heats of combustion of some amino-acids | journal = Russ. J. Phys. Chem. (Engl. Transl.) | year = 1960 | volume = 34 | pages = 1182–83}}</ref>
| DeltaHc = −2805&nbsp;kJ/mol
| Entropy = 209.2&nbsp;J K<sup>−1</sup> mol<sup>−1</sup><ref name="Boerio-Goates 1991 403–9">{{citation | last = Boerio-Goates | first = Juliana | title = Heat-capacity measurements and thermodynamic functions of crystalline α-D-glucose at temperatures from 10K to 340K | journal = J. Chem. Thermodynam. | year = 1991 | volume = 23 | issue = 5 | pages = 403–09 | doi = 10.1016/S0021-9614(05)80128-4}}</ref>
| HeatCapacity = 218.6 J K<sup>−1</sup> mol<sup>−1</sup><ref name="Boerio-Goates 1991 403–9"/>
  }}
|Section6={{Chembox Pharmacology
| ATCCode_prefix = B05
| ATCCode_suffix = CX01
| ATC_Supplemental = {{ATC|V04|CA02}}, {{ATC|V06|DC01}}
}}
|Section7={{Chembox Hazards
| ExternalSDS = [http://www.inchem.org/documents/icsc/icsc/eics0865.htm ICSC 08655]
| NFPA-H = 0
| NFPA-F = 1
| NFPA-R = 0
  }}
}}
'''Qlükoza''' ({{Dil-el|[[:el:Γλυκόζη|γλυκόζη]]}}, γλυκύς - dan ''şirin'') və ya '''üzüm [[şəkər]]i''' və ya '''dekstroza'''. Şirin dadlı, suda yaxşı həll olan ağ kristal maddədir. Qlükoza bitki və canlı orqanizmlərdə, həmçinin, bir çox meyvə və giləmeyvə şirələrində rast gəlinir.

Qlükoza [[orqanizm]]in enerji sərfinin yarsını təmin edir.

Üzvi maddələrə aiddir. Qlükoza müxtəlif iynələrə, sistemlərə əlavə olunur. Qlükozanın insana həm xeyiri, həm də ziyanı var.

== Quruluşu ==
Qlükoza beşatomlu aldehidspirtdir.

== Tətbiqi ==
Qlükoza qiymətli və asan həzm olunan qida maddəsidir. tibbdə qlükozadan qanın konservləşdirilməsində və orqanizmi möhkəmləndirən maddə kimi istifadə olunur. Qlükoza qənnnadı sənayesində, güzgü və yolka oyuncaqlarının hazırlanmasında, toxuculuq sənayesində parşalara bəzək vurulmasında işlədilir.

== Mənbə ==
* [http://www.prochrom.ru/ru/view/?info=vesh&id=7 D-Qlükoza (dekstroza, )]
* [http://food-facts.ru/food-biochemistry/carbohydrates-glucose-fructose.html] {{Vebarxiv|url=https://web.archive.org/web/20121104091838/http://food-facts.ru/food-biochemistry/carbohydrates-glucose-fructose.html |date=2012-11-04 }}

== İstinadlar ==
{{İstinad siyahısı}}

== Xarici keçidlər ==
{{Xarici keçidlər}}

{{Kimya-qaralama}}

[[Kateqoriya:Şəkər]]
[[Kateqoriya:Ümumdünya Səhiyyə Təşkilatının əsas dərman vasitələri]]